What is the Benzonitrile,4-methyl-?

Benzonitrile,4-methyl- is beige solid, while it's Molecular Formula is C8H7N. beige solid p-?Tolunitrile is a reagent used in the preparation of 1H-Indazoles from imidates and nitrosobenzenes.

What is the CAS number for Benzonitrile,4-methyl-?

The CAS number of Benzonitrile,4-methyl- is 104-85-8.

What is Benzonitrile,4-methyl- (104-85-8) used for?

Benzonitrile,4-methyl-, also known as p-Tolunitrile, is a beige solid with chemical properties that make it a valuable compound in various applications. It is characterized by its beige solid appearance and is known for its use as a reagent in the chemical synthesis process.InChI:InChI=1/C8H7N/c1-7-2-4-8(6-9)5-3-7/h2-5H,1H3